C23H25ClN2O2 — CID 55583894
(4-chlorophenyl)-[2-(4-cyclopentylpiperazine-1-carbonyl)phenyl]methanone (PubChem CID 55583894) has the molecular formula C23H25ClN2O2 and a molecular weight of 396.92 g/mol. Its IUPAC name is (4-chlorophenyl)-[2-(4-cyclopentylpiperazine-1-carbonyl)phenyl]methanone.
| Compound Name | (4-chlorophenyl)-[2-(4-cyclopentylpiperazine-1-carbonyl)phenyl]methanone |
|---|---|
| PubChem CID | 55583894 |
| Molecular Formula | C23H25ClN2O2 |
| Molecular Weight | 396.92 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | (4-chlorophenyl)-[2-(4-cyclopentylpiperazine-1-carbonyl)phenyl]methanone |
| SMILES | O=C(c1ccc(Cl)cc1)c1ccccc1C(=O)N1CCN(C2CCCC2)CC1 |
| InChI | InChI=1S/C23H25ClN2O2/c24-18-11-9-17(10-12-18)22(27)20-7-3-4-8-21(20)23(28)26-15-13-25(14-16-26)19-5-1-2-6-19/h3-4,7-12,19H,1-2,5-6,13-16H2 |
| InChIKey | KSKILINKXXRCJR-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.92 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |