C23H21ClN2O3 — CID 19572522
(4-chlorophenyl)-[2-[4-(furan-2-ylmethyl)piperazine-1-carbonyl]phenyl]methanone (PubChem CID 19572522) has the molecular formula C23H21ClN2O3 and a molecular weight of 408.89 g/mol. Its IUPAC name is (4-chlorophenyl)-[2-[4-(furan-2-ylmethyl)piperazine-1-carbonyl]phenyl]methanone.
| Compound Name | (4-chlorophenyl)-[2-[4-(furan-2-ylmethyl)piperazine-1-carbonyl]phenyl]methanone |
|---|---|
| PubChem CID | 19572522 |
| Molecular Formula | C23H21ClN2O3 |
| Molecular Weight | 408.89 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | (4-chlorophenyl)-[2-[4-(furan-2-ylmethyl)piperazine-1-carbonyl]phenyl]methanone |
| SMILES | O=C(c1ccc(Cl)cc1)c1ccccc1C(=O)N1CCN(Cc2ccco2)CC1 |
| InChI | InChI=1S/C23H21ClN2O3/c24-18-9-7-17(8-10-18)22(27)20-5-1-2-6-21(20)23(28)26-13-11-25(12-14-26)16-19-4-3-15-29-19/h1-10,15H,11-14,16H2 |
| InChIKey | ZCPOULIXULSFRE-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 53.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.89 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |