C16H25Cl2N3O — CID 119946429
(2-aminophenyl)-(4-cyclopentylpiperazin-1-yl)methanone;dihydrochloride (PubChem CID 119946429) has the molecular formula C16H25Cl2N3O and a molecular weight of 346.30 g/mol. Its IUPAC name is (2-aminophenyl)-(4-cyclopentylpiperazin-1-yl)methanone;dihydrochloride.
| Compound Name | (2-aminophenyl)-(4-cyclopentylpiperazin-1-yl)methanone;dihydrochloride |
|---|---|
| PubChem CID | 119946429 |
| Molecular Formula | C16H25Cl2N3O |
| Molecular Weight | 346.30 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | (2-aminophenyl)-(4-cyclopentylpiperazin-1-yl)methanone;dihydrochloride |
| SMILES | Cl.Cl.Nc1ccccc1C(=O)N1CCN(C2CCCC2)CC1 |
| InChI | InChI=1S/C16H23N3O.2ClH/c17-15-8-4-3-7-14(15)16(20)19-11-9-18(10-12-19)13-5-1-2-6-13;;/h3-4,7-8,13H,1-2,5-6,9-12,17H2;2*1H |
| InChIKey | MDFMYNAQJVRZOS-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.30 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|