C19H31Cl2N3O — CID 119946751
(2-aminophenyl)-[4-(cyclohexylmethyl)-1,4-diazepan-1-yl]methanone;dihydrochloride (PubChem CID 119946751) has the molecular formula C19H31Cl2N3O and a molecular weight of 388.38 g/mol. Its IUPAC name is (2-aminophenyl)-[4-(cyclohexylmethyl)-1,4-diazepan-1-yl]methanone;dihydrochloride.
| Compound Name | (2-aminophenyl)-[4-(cyclohexylmethyl)-1,4-diazepan-1-yl]methanone;dihydrochloride |
|---|---|
| PubChem CID | 119946751 |
| Molecular Formula | C19H31Cl2N3O |
| Molecular Weight | 388.38 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | (2-aminophenyl)-[4-(cyclohexylmethyl)-1,4-diazepan-1-yl]methanone;dihydrochloride |
| SMILES | Cl.Cl.Nc1ccccc1C(=O)N1CCCN(CC2CCCCC2)CC1 |
| InChI | InChI=1S/C19H29N3O.2ClH/c20-18-10-5-4-9-17(18)19(23)22-12-6-11-21(13-14-22)15-16-7-2-1-3-8-16;;/h4-5,9-10,16H,1-3,6-8,11-15,20H2;2*1H |
| InChIKey | YVMDKKUNHGKYBH-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.38 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|