C17H16Cl2N4O2S — CID 24852838
2-[[4-(3,5-dichloro-4-pyridinyl)-1,4-diazepan-1-yl]sulfonyl]benzonitrile (PubChem CID 24852838) has the molecular formula C17H16Cl2N4O2S and a molecular weight of 411.31 g/mol. Its IUPAC name is 2-[[4-(3,5-dichloro-4-pyridinyl)-1,4-diazepan-1-yl]sulfonyl]benzonitrile.
| Compound Name | 2-[[4-(3,5-dichloro-4-pyridinyl)-1,4-diazepan-1-yl]sulfonyl]benzonitrile |
|---|---|
| PubChem CID | 24852838 |
| Molecular Formula | C17H16Cl2N4O2S |
| Molecular Weight | 411.31 g/mol |
| Exact Mass | 410.04 |
| IUPAC Name | 2-[[4-(3,5-dichloro-4-pyridinyl)-1,4-diazepan-1-yl]sulfonyl]benzonitrile |
| SMILES | N#Cc1ccccc1S(=O)(=O)N1CCCN(c2c(Cl)cncc2Cl)CC1 |
| InChI | InChI=1S/C17H16Cl2N4O2S/c18-14-11-21-12-15(19)17(14)22-6-3-7-23(9-8-22)26(24,25)16-5-2-1-4-13(16)10-20/h1-2,4-5,11-12H,3,6-9H2 |
| InChIKey | ORLKCSWLQNCMAS-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 77.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.31 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |