C19H20ClN5O3S — CID 122342145
4-[4-(5-chloro-2-methoxyphenyl)sulfonylpiperazin-1-yl]-6-pyrrol-1-ylpyrimidine (PubChem CID 122342145) has the molecular formula C19H20ClN5O3S and a molecular weight of 433.92 g/mol. Its IUPAC name is 4-[4-(5-chloro-2-methoxyphenyl)sulfonylpiperazin-1-yl]-6-pyrrol-1-ylpyrimidine.
| Compound Name | 4-[4-(5-chloro-2-methoxyphenyl)sulfonylpiperazin-1-yl]-6-pyrrol-1-ylpyrimidine |
|---|---|
| PubChem CID | 122342145 |
| Molecular Formula | C19H20ClN5O3S |
| Molecular Weight | 433.92 g/mol |
| Exact Mass | 433.10 |
| IUPAC Name | 4-[4-(5-chloro-2-methoxyphenyl)sulfonylpiperazin-1-yl]-6-pyrrol-1-ylpyrimidine |
| SMILES | COc1ccc(Cl)cc1S(=O)(=O)N1CCN(c2cc(-n3cccc3)ncn2)CC1 |
| InChI | InChI=1S/C19H20ClN5O3S/c1-28-16-5-4-15(20)12-17(16)29(26,27)25-10-8-24(9-11-25)19-13-18(21-14-22-19)23-6-2-3-7-23/h2-7,12-14H,8-11H2,1H3 |
| InChIKey | AZRVCDNIMYUVPB-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 80.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.92 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |