C20H20ClN5O3S — CID 90490660
3-[4-(5-chloro-2-methoxyphenyl)sulfonylpiperazin-1-yl]-6-pyridin-2-ylpyridazine (PubChem CID 90490660) has the molecular formula C20H20ClN5O3S and a molecular weight of 445.93 g/mol. Its IUPAC name is 3-[4-(5-chloro-2-methoxyphenyl)sulfonylpiperazin-1-yl]-6-pyridin-2-ylpyridazine.
| Compound Name | 3-[4-(5-chloro-2-methoxyphenyl)sulfonylpiperazin-1-yl]-6-pyridin-2-ylpyridazine |
|---|---|
| PubChem CID | 90490660 |
| Molecular Formula | C20H20ClN5O3S |
| Molecular Weight | 445.93 g/mol |
| Exact Mass | 445.10 |
| IUPAC Name | 3-[4-(5-chloro-2-methoxyphenyl)sulfonylpiperazin-1-yl]-6-pyridin-2-ylpyridazine |
| SMILES | COc1ccc(Cl)cc1S(=O)(=O)N1CCN(c2ccc(-c3ccccn3)nn2)CC1 |
| InChI | InChI=1S/C20H20ClN5O3S/c1-29-18-7-5-15(21)14-19(18)30(27,28)26-12-10-25(11-13-26)20-8-6-17(23-24-20)16-4-2-3-9-22-16/h2-9,14H,10-13H2,1H3 |
| InChIKey | LUPFYKYRFPUGKC-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 88.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.93 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |