C19H17Cl2N5O2S — CID 90490634
3-[4-(2,5-dichlorophenyl)sulfonylpiperazin-1-yl]-6-pyridin-2-ylpyridazine (PubChem CID 90490634) has the molecular formula C19H17Cl2N5O2S and a molecular weight of 450.35 g/mol. Its IUPAC name is 3-[4-(2,5-dichlorophenyl)sulfonylpiperazin-1-yl]-6-pyridin-2-ylpyridazine.
| Compound Name | 3-[4-(2,5-dichlorophenyl)sulfonylpiperazin-1-yl]-6-pyridin-2-ylpyridazine |
|---|---|
| PubChem CID | 90490634 |
| Molecular Formula | C19H17Cl2N5O2S |
| Molecular Weight | 450.35 g/mol |
| Exact Mass | 449.05 |
| IUPAC Name | 3-[4-(2,5-dichlorophenyl)sulfonylpiperazin-1-yl]-6-pyridin-2-ylpyridazine |
| SMILES | O=S(=O)(c1cc(Cl)ccc1Cl)N1CCN(c2ccc(-c3ccccn3)nn2)CC1 |
| InChI | InChI=1S/C19H17Cl2N5O2S/c20-14-4-5-15(21)18(13-14)29(27,28)26-11-9-25(10-12-26)19-7-6-17(23-24-19)16-3-1-2-8-22-16/h1-8,13H,9-12H2 |
| InChIKey | WPKSPIFTELSHCP-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 79.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.35 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |