C22H22N4O2 — CID 53081404
6-(4-benzoyl-1,4-diazepan-1-yl)-2-phenylpyridazin-3-one (PubChem CID 53081404) has the molecular formula C22H22N4O2 and a molecular weight of 374.44 g/mol. Its IUPAC name is 6-(4-benzoyl-1,4-diazepan-1-yl)-2-phenylpyridazin-3-one.
| Compound Name | 6-(4-benzoyl-1,4-diazepan-1-yl)-2-phenylpyridazin-3-one |
|---|---|
| PubChem CID | 53081404 |
| Molecular Formula | C22H22N4O2 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | 6-(4-benzoyl-1,4-diazepan-1-yl)-2-phenylpyridazin-3-one |
| SMILES | O=C(c1ccccc1)N1CCCN(c2ccc(=O)n(-c3ccccc3)n2)CC1 |
| InChI | InChI=1S/C22H22N4O2/c27-21-13-12-20(23-26(21)19-10-5-2-6-11-19)24-14-7-15-25(17-16-24)22(28)18-8-3-1-4-9-18/h1-6,8-13H,7,14-17H2 |
| InChIKey | JMPZUWMDAABSOP-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |