C20H24N4O3 — CID 93068578
6-[4-[(2R)-oxolane-2-carbonyl]-1,4-diazepan-1-yl]-2-phenylpyridazin-3-one (PubChem CID 93068578) has the molecular formula C20H24N4O3 and a molecular weight of 368.44 g/mol. Its IUPAC name is 6-[4-[(2R)-oxolane-2-carbonyl]-1,4-diazepan-1-yl]-2-phenylpyridazin-3-one.
| Compound Name | 6-[4-[(2R)-oxolane-2-carbonyl]-1,4-diazepan-1-yl]-2-phenylpyridazin-3-one |
|---|---|
| PubChem CID | 93068578 |
| Molecular Formula | C20H24N4O3 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | 6-[4-[(2R)-oxolane-2-carbonyl]-1,4-diazepan-1-yl]-2-phenylpyridazin-3-one |
| SMILES | O=C([C@H]1CCCO1)N1CCCN(c2ccc(=O)n(-c3ccccc3)n2)CC1 |
| InChI | InChI=1S/C20H24N4O3/c25-19-10-9-18(21-24(19)16-6-2-1-3-7-16)22-11-5-12-23(14-13-22)20(26)17-8-4-15-27-17/h1-3,6-7,9-10,17H,4-5,8,11-15H2/t17-/m1/s1 |
| InChIKey | MQCRYAJSDRGFSA-QGZVFWFLSA-N |
| XLogP | 1.45 |
| TPSA | 67.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |