C14H21ClN2O4S2 — CID 51170108
1-butylsulfonyl-4-(3-chlorophenyl)sulfonylpiperazine (PubChem CID 51170108) has the molecular formula C14H21ClN2O4S2 and a molecular weight of 380.92 g/mol. Its IUPAC name is 1-butylsulfonyl-4-(3-chlorophenyl)sulfonylpiperazine.
| Compound Name | 1-butylsulfonyl-4-(3-chlorophenyl)sulfonylpiperazine |
|---|---|
| PubChem CID | 51170108 |
| Molecular Formula | C14H21ClN2O4S2 |
| Molecular Weight | 380.92 g/mol |
| Exact Mass | 380.06 |
| IUPAC Name | 1-butylsulfonyl-4-(3-chlorophenyl)sulfonylpiperazine |
| SMILES | CCCCS(=O)(=O)N1CCN(S(=O)(=O)c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C14H21ClN2O4S2/c1-2-3-11-22(18,19)16-7-9-17(10-8-16)23(20,21)14-6-4-5-13(15)12-14/h4-6,12H,2-3,7-11H2,1H3 |
| InChIKey | CLTABXHAXSNBLJ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.92 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |