C17H17BrF2N2O4S2 — CID 26530634
1-(4-bromo-3-methylphenyl)sulfonyl-4-(2,4-difluorophenyl)sulfonylpiperazine (PubChem CID 26530634) has the molecular formula C17H17BrF2N2O4S2 and a molecular weight of 495.37 g/mol. Its IUPAC name is 1-(4-bromo-3-methylphenyl)sulfonyl-4-(2,4-difluorophenyl)sulfonylpiperazine.
| Compound Name | 1-(4-bromo-3-methylphenyl)sulfonyl-4-(2,4-difluorophenyl)sulfonylpiperazine |
|---|---|
| PubChem CID | 26530634 |
| Molecular Formula | C17H17BrF2N2O4S2 |
| Molecular Weight | 495.37 g/mol |
| Exact Mass | 493.98 |
| IUPAC Name | 1-(4-bromo-3-methylphenyl)sulfonyl-4-(2,4-difluorophenyl)sulfonylpiperazine |
| SMILES | Cc1cc(S(=O)(=O)N2CCN(S(=O)(=O)c3ccc(F)cc3F)CC2)ccc1Br |
| InChI | InChI=1S/C17H17BrF2N2O4S2/c1-12-10-14(3-4-15(12)18)27(23,24)21-6-8-22(9-7-21)28(25,26)17-5-2-13(19)11-16(17)20/h2-5,10-11H,6-9H2,1H3 |
| InChIKey | XZMKSFHPWBOMET-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.37 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |