C18H23NO2S — CID 70948532
3-butyl-1-naphthalen-2-ylsulfonylpyrrolidine (PubChem CID 70948532) has the molecular formula C18H23NO2S and a molecular weight of 317.45 g/mol. Its IUPAC name is 3-butyl-1-naphthalen-2-ylsulfonylpyrrolidine.
| Compound Name | 3-butyl-1-naphthalen-2-ylsulfonylpyrrolidine |
|---|---|
| PubChem CID | 70948532 |
| Molecular Formula | C18H23NO2S |
| Molecular Weight | 317.45 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 3-butyl-1-naphthalen-2-ylsulfonylpyrrolidine |
| SMILES | CCCCC1CCN(S(=O)(=O)c2ccc3ccccc3c2)C1 |
| InChI | InChI=1S/C18H23NO2S/c1-2-3-6-15-11-12-19(14-15)22(20,21)18-10-9-16-7-4-5-8-17(16)13-18/h4-5,7-10,13,15H,2-3,6,11-12,14H2,1H3 |
| InChIKey | WYACSUAVLBEBRF-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.45 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |