C19H24N2O4S — CID 11848948
N-hydroxy-4-(1-naphthalen-2-ylsulfonylpiperidin-4-yl)butanamide (PubChem CID 11848948) has the molecular formula C19H24N2O4S and a molecular weight of 376.48 g/mol. Its IUPAC name is N-hydroxy-4-(1-naphthalen-2-ylsulfonylpiperidin-4-yl)butanamide.
| Compound Name | N-hydroxy-4-(1-naphthalen-2-ylsulfonylpiperidin-4-yl)butanamide |
|---|---|
| PubChem CID | 11848948 |
| Molecular Formula | C19H24N2O4S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | N-hydroxy-4-(1-naphthalen-2-ylsulfonylpiperidin-4-yl)butanamide |
| SMILES | O=C(CCCC1CCN(S(=O)(=O)c2ccc3ccccc3c2)CC1)NO |
| InChI | InChI=1S/C19H24N2O4S/c22-19(20-23)7-3-4-15-10-12-21(13-11-15)26(24,25)18-9-8-16-5-1-2-6-17(16)14-18/h1-2,5-6,8-9,14-15,23H,3-4,7,10-13H2,(H,20,22) |
| InChIKey | XHWFWAWCHFDPAQ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|