C18H23N3O5S — CID 57403166
N-hydroxy-4-[1-[4-(1,3-oxazol-5-yl)phenyl]sulfonylpiperidin-4-yl]butanamide (PubChem CID 57403166) has the molecular formula C18H23N3O5S and a molecular weight of 393.47 g/mol. Its IUPAC name is N-hydroxy-4-[1-[4-(1,3-oxazol-5-yl)phenyl]sulfonylpiperidin-4-yl]butanamide.
| Compound Name | N-hydroxy-4-[1-[4-(1,3-oxazol-5-yl)phenyl]sulfonylpiperidin-4-yl]butanamide |
|---|---|
| PubChem CID | 57403166 |
| Molecular Formula | C18H23N3O5S |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | N-hydroxy-4-[1-[4-(1,3-oxazol-5-yl)phenyl]sulfonylpiperidin-4-yl]butanamide |
| SMILES | O=C(CCCC1CCN(S(=O)(=O)c2ccc(-c3cnco3)cc2)CC1)NO |
| InChI | InChI=1S/C18H23N3O5S/c22-18(20-23)3-1-2-14-8-10-21(11-9-14)27(24,25)16-6-4-15(5-7-16)17-12-19-13-26-17/h4-7,12-14,23H,1-3,8-11H2,(H,20,22) |
| InChIKey | WGISCGSLSUFHGP-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 112.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|