C15H20ClN3O5S — CID 122021772
4-[[4-(4-chlorophenyl)sulfonylpiperazine-1-carbonyl]amino]butanoic acid (PubChem CID 122021772) has the molecular formula C15H20ClN3O5S and a molecular weight of 389.86 g/mol. Its IUPAC name is 4-[[4-(4-chlorophenyl)sulfonylpiperazine-1-carbonyl]amino]butanoic acid.
| Compound Name | 4-[[4-(4-chlorophenyl)sulfonylpiperazine-1-carbonyl]amino]butanoic acid |
|---|---|
| PubChem CID | 122021772 |
| Molecular Formula | C15H20ClN3O5S |
| Molecular Weight | 389.86 g/mol |
| Exact Mass | 389.08 |
| IUPAC Name | 4-[[4-(4-chlorophenyl)sulfonylpiperazine-1-carbonyl]amino]butanoic acid |
| SMILES | O=C(O)CCCNC(=O)N1CCN(S(=O)(=O)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C15H20ClN3O5S/c16-12-3-5-13(6-4-12)25(23,24)19-10-8-18(9-11-19)15(22)17-7-1-2-14(20)21/h3-6H,1-2,7-11H2,(H,17,22)(H,20,21) |
| InChIKey | SVTWEEJINJBNIP-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.86 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|