C20H22Cl2N2O3S — CID 55771420
4-(4-chlorophenyl)-1-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]butan-1-one (PubChem CID 55771420) has the molecular formula C20H22Cl2N2O3S and a molecular weight of 441.38 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-1-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]butan-1-one.
| Compound Name | 4-(4-chlorophenyl)-1-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 55771420 |
| Molecular Formula | C20H22Cl2N2O3S |
| Molecular Weight | 441.38 g/mol |
| Exact Mass | 440.07 |
| IUPAC Name | 4-(4-chlorophenyl)-1-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]butan-1-one |
| SMILES | O=C(CCCc1ccc(Cl)cc1)N1CCN(S(=O)(=O)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C20H22Cl2N2O3S/c21-17-6-4-16(5-7-17)2-1-3-20(25)23-12-14-24(15-13-23)28(26,27)19-10-8-18(22)9-11-19/h4-11H,1-3,12-15H2 |
| InChIKey | DXUHJZAXJMHZIA-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.38 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |