C17H22Cl2N2O2 — CID 108569833
4-chloro-1-[4-[3-(4-chlorophenyl)propanoyl]piperazin-1-yl]butan-1-one (PubChem CID 108569833) has the molecular formula C17H22Cl2N2O2 and a molecular weight of 357.28 g/mol. Its IUPAC name is 4-chloro-1-[4-[3-(4-chlorophenyl)propanoyl]piperazin-1-yl]butan-1-one.
| Compound Name | 4-chloro-1-[4-[3-(4-chlorophenyl)propanoyl]piperazin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 108569833 |
| Molecular Formula | C17H22Cl2N2O2 |
| Molecular Weight | 357.28 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | 4-chloro-1-[4-[3-(4-chlorophenyl)propanoyl]piperazin-1-yl]butan-1-one |
| SMILES | O=C(CCCCl)N1CCN(C(=O)CCc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C17H22Cl2N2O2/c18-9-1-2-16(22)20-10-12-21(13-11-20)17(23)8-5-14-3-6-15(19)7-4-14/h3-4,6-7H,1-2,5,8-13H2 |
| InChIKey | JBRZORVUEUOROI-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.28 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|