C18H16F3N3O3 — CID 69111066
(2,6-difluorophenyl)-[4-[(2-fluoro-4-nitrophenyl)methyl]piperazin-1-yl]methanone (PubChem CID 69111066) has the molecular formula C18H16F3N3O3 and a molecular weight of 379.34 g/mol. Its IUPAC name is (2,6-difluorophenyl)-[4-[(2-fluoro-4-nitrophenyl)methyl]piperazin-1-yl]methanone.
| Compound Name | (2,6-difluorophenyl)-[4-[(2-fluoro-4-nitrophenyl)methyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 69111066 |
| Molecular Formula | C18H16F3N3O3 |
| Molecular Weight | 379.34 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | (2,6-difluorophenyl)-[4-[(2-fluoro-4-nitrophenyl)methyl]piperazin-1-yl]methanone |
| SMILES | O=C(c1c(F)cccc1F)N1CCN(Cc2ccc([N+](=O)[O-])cc2F)CC1 |
| InChI | InChI=1S/C18H16F3N3O3/c19-14-2-1-3-15(20)17(14)18(25)23-8-6-22(7-9-23)11-12-4-5-13(24(26)27)10-16(12)21/h1-5,10H,6-9,11H2 |
| InChIKey | ZGZBQYUQOLBVST-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 66.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.34 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|