C23H21F2N3O5 — CID 19292910
[4-[(2,3-difluorophenyl)methyl]piperazin-1-yl]-[5-[(4-nitrophenoxy)methyl]furan-2-yl]methanone (PubChem CID 19292910) has the molecular formula C23H21F2N3O5 and a molecular weight of 457.43 g/mol. Its IUPAC name is [4-[(2,3-difluorophenyl)methyl]piperazin-1-yl]-[5-[(4-nitrophenoxy)methyl]furan-2-yl]methanone.
| Compound Name | [4-[(2,3-difluorophenyl)methyl]piperazin-1-yl]-[5-[(4-nitrophenoxy)methyl]furan-2-yl]methanone |
|---|---|
| PubChem CID | 19292910 |
| Molecular Formula | C23H21F2N3O5 |
| Molecular Weight | 457.43 g/mol |
| Exact Mass | 457.14 |
| IUPAC Name | [4-[(2,3-difluorophenyl)methyl]piperazin-1-yl]-[5-[(4-nitrophenoxy)methyl]furan-2-yl]methanone |
| SMILES | O=C(c1ccc(COc2ccc([N+](=O)[O-])cc2)o1)N1CCN(Cc2cccc(F)c2F)CC1 |
| InChI | InChI=1S/C23H21F2N3O5/c24-20-3-1-2-16(22(20)25)14-26-10-12-27(13-11-26)23(29)21-9-8-19(33-21)15-32-18-6-4-17(5-7-18)28(30)31/h1-9H,10-15H2 |
| InChIKey | ZZKKYSNDJYWMMW-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 89.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.43 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|