C26H31N3O5 — CID 4766134
[4-(1-adamantyl)piperazin-1-yl]-[5-[(4-nitrophenoxy)methyl]furan-2-yl]methanone (PubChem CID 4766134) has the molecular formula C26H31N3O5 and a molecular weight of 465.55 g/mol. Its IUPAC name is [4-(1-adamantyl)piperazin-1-yl]-[5-[(4-nitrophenoxy)methyl]furan-2-yl]methanone.
| Compound Name | [4-(1-adamantyl)piperazin-1-yl]-[5-[(4-nitrophenoxy)methyl]furan-2-yl]methanone |
|---|---|
| PubChem CID | 4766134 |
| Molecular Formula | C26H31N3O5 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.23 |
| IUPAC Name | [4-(1-adamantyl)piperazin-1-yl]-[5-[(4-nitrophenoxy)methyl]furan-2-yl]methanone |
| SMILES | O=C(c1ccc(COc2ccc([N+](=O)[O-])cc2)o1)N1CCN(C23CC4CC(CC(C4)C2)C3)CC1 |
| InChI | InChI=1S/C26H31N3O5/c30-25(24-6-5-23(34-24)17-33-22-3-1-21(2-4-22)29(31)32)27-7-9-28(10-8-27)26-14-18-11-19(15-26)13-20(12-18)16-26/h1-6,18-20H,7-17H2 |
| InChIKey | AJUSRDDPUBVFNX-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 89.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|