C15H18ClFN2O3S — CID 2810274
2-[2-[4-[(2-chloro-6-fluorophenyl)methyl]piperazin-1-yl]-2-oxoethyl]sulfanylacetic acid (PubChem CID 2810274) has the molecular formula C15H18ClFN2O3S and a molecular weight of 360.84 g/mol. Its IUPAC name is 2-[2-[4-[(2-chloro-6-fluorophenyl)methyl]piperazin-1-yl]-2-oxoethyl]sulfanylacetic acid.
| Compound Name | 2-[2-[4-[(2-chloro-6-fluorophenyl)methyl]piperazin-1-yl]-2-oxoethyl]sulfanylacetic acid |
|---|---|
| PubChem CID | 2810274 |
| Molecular Formula | C15H18ClFN2O3S |
| Molecular Weight | 360.84 g/mol |
| Exact Mass | 360.07 |
| IUPAC Name | 2-[2-[4-[(2-chloro-6-fluorophenyl)methyl]piperazin-1-yl]-2-oxoethyl]sulfanylacetic acid |
| SMILES | O=C(O)CSCC(=O)N1CCN(Cc2c(F)cccc2Cl)CC1 |
| InChI | InChI=1S/C15H18ClFN2O3S/c16-12-2-1-3-13(17)11(12)8-18-4-6-19(7-5-18)14(20)9-23-10-15(21)22/h1-3H,4-10H2,(H,21,22) |
| InChIKey | NSNNOUXACUBWRX-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.84 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |