C22H27NO3 — CID 70598788
(3,4-dimethoxyphenyl)-[4-(4-ethylphenyl)piperidin-1-yl]methanone (PubChem CID 70598788) has the molecular formula C22H27NO3 and a molecular weight of 353.46 g/mol. Its IUPAC name is (3,4-dimethoxyphenyl)-[4-(4-ethylphenyl)piperidin-1-yl]methanone.
| Compound Name | (3,4-dimethoxyphenyl)-[4-(4-ethylphenyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 70598788 |
| Molecular Formula | C22H27NO3 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | (3,4-dimethoxyphenyl)-[4-(4-ethylphenyl)piperidin-1-yl]methanone |
| SMILES | CCc1ccc(C2CCN(C(=O)c3ccc(OC)c(OC)c3)CC2)cc1 |
| InChI | InChI=1S/C22H27NO3/c1-4-16-5-7-17(8-6-16)18-11-13-23(14-12-18)22(24)19-9-10-20(25-2)21(15-19)26-3/h5-10,15,18H,4,11-14H2,1-3H3 |
| InChIKey | SJELADXIIYQXGS-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |