C12H15NO2S — CID 82116951
1-(azepan-1-yl)-2-thiophen-2-ylethane-1,2-dione (PubChem CID 82116951) has the molecular formula C12H15NO2S and a molecular weight of 237.32 g/mol. Its IUPAC name is 1-(azepan-1-yl)-2-thiophen-2-ylethane-1,2-dione.
| Compound Name | 1-(azepan-1-yl)-2-thiophen-2-ylethane-1,2-dione |
|---|---|
| PubChem CID | 82116951 |
| Molecular Formula | C12H15NO2S |
| Molecular Weight | 237.32 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | 1-(azepan-1-yl)-2-thiophen-2-ylethane-1,2-dione |
| SMILES | O=C(C(=O)N1CCCCCC1)c1cccs1 |
| InChI | InChI=1S/C12H15NO2S/c14-11(10-6-5-9-16-10)12(15)13-7-3-1-2-4-8-13/h5-6,9H,1-4,7-8H2 |
| InChIKey | ANOOKXKKJJNUTR-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.32 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|