C16H23ClF3N3O — CID 19554375
3-[4-chloro-5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]-N-hexylpropanamide (PubChem CID 19554375) has the molecular formula C16H23ClF3N3O and a molecular weight of 365.83 g/mol. Its IUPAC name is 3-[4-chloro-5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]-N-hexylpropanamide.
| Compound Name | 3-[4-chloro-5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]-N-hexylpropanamide |
|---|---|
| PubChem CID | 19554375 |
| Molecular Formula | C16H23ClF3N3O |
| Molecular Weight | 365.83 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | 3-[4-chloro-5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]-N-hexylpropanamide |
| SMILES | CCCCCCNC(=O)CCn1nc(C(F)(F)F)c(Cl)c1C1CC1 |
| InChI | InChI=1S/C16H23ClF3N3O/c1-2-3-4-5-9-21-12(24)8-10-23-14(11-6-7-11)13(17)15(22-23)16(18,19)20/h11H,2-10H2,1H3,(H,21,24) |
| InChIKey | YOGIBWBICAPNLY-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.83 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|