C22H25F3N6S — CID 19334352
1-[3-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-3-[1-[(4-methylphenyl)methyl]pyrazol-4-yl]thiourea (PubChem CID 19334352) has the molecular formula C22H25F3N6S and a molecular weight of 462.55 g/mol. Its IUPAC name is 1-[3-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-3-[1-[(4-methylphenyl)methyl]pyrazol-4-yl]thiourea.
| Compound Name | 1-[3-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-3-[1-[(4-methylphenyl)methyl]pyrazol-4-yl]thiourea |
|---|---|
| PubChem CID | 19334352 |
| Molecular Formula | C22H25F3N6S |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | 1-[3-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]propyl]-3-[1-[(4-methylphenyl)methyl]pyrazol-4-yl]thiourea |
| SMILES | Cc1ccc(Cn2cc(NC(=S)NCCCn3nc(C(F)(F)F)cc3C3CC3)cn2)cc1 |
| InChI | InChI=1S/C22H25F3N6S/c1-15-3-5-16(6-4-15)13-30-14-18(12-27-30)28-21(32)26-9-2-10-31-19(17-7-8-17)11-20(29-31)22(23,24)25/h3-6,11-12,14,17H,2,7-10,13H2,1H3,(H2,26,28,32) |
| InChIKey | FVKIYIFWIRANKT-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 59.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|