C17H18BrClN6S — CID 19324914
1-[4-bromo-1-[(2-chlorophenyl)methyl]pyrazol-3-yl]-3-[(1,3-dimethylpyrazol-4-yl)methyl]thiourea (PubChem CID 19324914) has the molecular formula C17H18BrClN6S and a molecular weight of 453.80 g/mol. Its IUPAC name is 1-[4-bromo-1-[(2-chlorophenyl)methyl]pyrazol-3-yl]-3-[(1,3-dimethylpyrazol-4-yl)methyl]thiourea.
| Compound Name | 1-[4-bromo-1-[(2-chlorophenyl)methyl]pyrazol-3-yl]-3-[(1,3-dimethylpyrazol-4-yl)methyl]thiourea |
|---|---|
| PubChem CID | 19324914 |
| Molecular Formula | C17H18BrClN6S |
| Molecular Weight | 453.80 g/mol |
| Exact Mass | 452.02 |
| IUPAC Name | 1-[4-bromo-1-[(2-chlorophenyl)methyl]pyrazol-3-yl]-3-[(1,3-dimethylpyrazol-4-yl)methyl]thiourea |
| SMILES | Cc1nn(C)cc1CNC(=S)Nc1nn(Cc2ccccc2Cl)cc1Br |
| InChI | InChI=1S/C17H18BrClN6S/c1-11-13(8-24(2)22-11)7-20-17(26)21-16-14(18)10-25(23-16)9-12-5-3-4-6-15(12)19/h3-6,8,10H,7,9H2,1-2H3,(H2,20,21,23,26) |
| InChIKey | IWVSSWOIECTXKQ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 59.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.80 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|