C21H17ClF2N6S — CID 19403440
1-[4-chloro-1-[(2-fluorophenyl)methyl]pyrazol-3-yl]-3-[1-[(4-fluorophenyl)methyl]pyrazol-4-yl]thiourea (PubChem CID 19403440) has the molecular formula C21H17ClF2N6S and a molecular weight of 458.93 g/mol. Its IUPAC name is 1-[4-chloro-1-[(2-fluorophenyl)methyl]pyrazol-3-yl]-3-[1-[(4-fluorophenyl)methyl]pyrazol-4-yl]thiourea.
| Compound Name | 1-[4-chloro-1-[(2-fluorophenyl)methyl]pyrazol-3-yl]-3-[1-[(4-fluorophenyl)methyl]pyrazol-4-yl]thiourea |
|---|---|
| PubChem CID | 19403440 |
| Molecular Formula | C21H17ClF2N6S |
| Molecular Weight | 458.93 g/mol |
| Exact Mass | 458.09 |
| IUPAC Name | 1-[4-chloro-1-[(2-fluorophenyl)methyl]pyrazol-3-yl]-3-[1-[(4-fluorophenyl)methyl]pyrazol-4-yl]thiourea |
| SMILES | Fc1ccc(Cn2cc(NC(=S)Nc3nn(Cc4ccccc4F)cc3Cl)cn2)cc1 |
| InChI | InChI=1S/C21H17ClF2N6S/c22-18-13-30(11-15-3-1-2-4-19(15)24)28-20(18)27-21(31)26-17-9-25-29(12-17)10-14-5-7-16(23)8-6-14/h1-9,12-13H,10-11H2,(H2,26,27,28,31) |
| InChIKey | RAMHXAGFVJLQJU-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 59.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.93 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|