C19H18ClFN4OS — CID 19405479
1-[1-[(2-chloro-4-fluorophenyl)methyl]-5-methylpyrazol-3-yl]-3-(2-methoxyphenyl)thiourea (PubChem CID 19405479) has the molecular formula C19H18ClFN4OS and a molecular weight of 404.90 g/mol. Its IUPAC name is 1-[1-[(2-chloro-4-fluorophenyl)methyl]-5-methylpyrazol-3-yl]-3-(2-methoxyphenyl)thiourea.
| Compound Name | 1-[1-[(2-chloro-4-fluorophenyl)methyl]-5-methylpyrazol-3-yl]-3-(2-methoxyphenyl)thiourea |
|---|---|
| PubChem CID | 19405479 |
| Molecular Formula | C19H18ClFN4OS |
| Molecular Weight | 404.90 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | 1-[1-[(2-chloro-4-fluorophenyl)methyl]-5-methylpyrazol-3-yl]-3-(2-methoxyphenyl)thiourea |
| SMILES | COc1ccccc1NC(=S)Nc1cc(C)n(Cc2ccc(F)cc2Cl)n1 |
| InChI | InChI=1S/C19H18ClFN4OS/c1-12-9-18(23-19(27)22-16-5-3-4-6-17(16)26-2)24-25(12)11-13-7-8-14(21)10-15(13)20/h3-10H,11H2,1-2H3,(H2,22,23,24,27) |
| InChIKey | QRAGBVUMFXIQNW-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 51.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.90 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|