C16H14ClN7O5 — CID 19529960
N-[3-[(4-chloropyrazol-1-yl)methyl]phenyl]-2-(5-methyl-3,4-dinitropyrazol-1-yl)acetamide (PubChem CID 19529960) has the molecular formula C16H14ClN7O5 and a molecular weight of 419.79 g/mol. Its IUPAC name is N-[3-[(4-chloropyrazol-1-yl)methyl]phenyl]-2-(5-methyl-3,4-dinitropyrazol-1-yl)acetamide.
| Compound Name | N-[3-[(4-chloropyrazol-1-yl)methyl]phenyl]-2-(5-methyl-3,4-dinitropyrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 19529960 |
| Molecular Formula | C16H14ClN7O5 |
| Molecular Weight | 419.79 g/mol |
| Exact Mass | 419.07 |
| IUPAC Name | N-[3-[(4-chloropyrazol-1-yl)methyl]phenyl]-2-(5-methyl-3,4-dinitropyrazol-1-yl)acetamide |
| SMILES | Cc1c([N+](=O)[O-])c([N+](=O)[O-])nn1CC(=O)Nc1cccc(Cn2cc(Cl)cn2)c1 |
| InChI | InChI=1S/C16H14ClN7O5/c1-10-15(23(26)27)16(24(28)29)20-22(10)9-14(25)19-13-4-2-3-11(5-13)7-21-8-12(17)6-18-21/h2-6,8H,7,9H2,1H3,(H,19,25) |
| InChIKey | RCMKNFLJIUCGPT-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 151.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.79 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|