C16H17ClN4O4 — CID 90622132
4-chloro-3-nitro-N-[1-(oxan-4-ylmethyl)pyrazol-4-yl]benzamide (PubChem CID 90622132) has the molecular formula C16H17ClN4O4 and a molecular weight of 364.79 g/mol. Its IUPAC name is 4-chloro-3-nitro-N-[1-(oxan-4-ylmethyl)pyrazol-4-yl]benzamide.
| Compound Name | 4-chloro-3-nitro-N-[1-(oxan-4-ylmethyl)pyrazol-4-yl]benzamide |
|---|---|
| PubChem CID | 90622132 |
| Molecular Formula | C16H17ClN4O4 |
| Molecular Weight | 364.79 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | 4-chloro-3-nitro-N-[1-(oxan-4-ylmethyl)pyrazol-4-yl]benzamide |
| SMILES | O=C(Nc1cnn(CC2CCOCC2)c1)c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H17ClN4O4/c17-14-2-1-12(7-15(14)21(23)24)16(22)19-13-8-18-20(10-13)9-11-3-5-25-6-4-11/h1-2,7-8,10-11H,3-6,9H2,(H,19,22) |
| InChIKey | LQDCEDLZHKHQAF-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.79 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|