C23H20FN7O6S — CID 19280441
N-[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]phenyl]-1-[(5-fluoro-2-nitrophenoxy)methyl]pyrazole-3-carboxamide (PubChem CID 19280441) has the molecular formula C23H20FN7O6S and a molecular weight of 541.52 g/mol. Its IUPAC name is N-[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]phenyl]-1-[(5-fluoro-2-nitrophenoxy)methyl]pyrazole-3-carboxamide.
| Compound Name | N-[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]phenyl]-1-[(5-fluoro-2-nitrophenoxy)methyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19280441 |
| Molecular Formula | C23H20FN7O6S |
| Molecular Weight | 541.52 g/mol |
| Exact Mass | 541.12 |
| IUPAC Name | N-[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]phenyl]-1-[(5-fluoro-2-nitrophenoxy)methyl]pyrazole-3-carboxamide |
| SMILES | Cc1cc(C)nc(NS(=O)(=O)c2ccc(NC(=O)c3ccn(COc4cc(F)ccc4[N+](=O)[O-])n3)cc2)n1 |
| InChI | InChI=1S/C23H20FN7O6S/c1-14-11-15(2)26-23(25-14)29-38(35,36)18-6-4-17(5-7-18)27-22(32)19-9-10-30(28-19)13-37-21-12-16(24)3-8-20(21)31(33)34/h3-12H,13H2,1-2H3,(H,27,32)(H,25,26,29) |
| InChIKey | MFWZLYHNGRKZOA-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 171.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.52 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|