C14H19N7O4 — CID 19396291
1-methyl-4-[[2-(3-methyl-4-nitropyrazol-1-yl)acetyl]amino]-N-propylpyrazole-5-carboxamide (PubChem CID 19396291) has the molecular formula C14H19N7O4 and a molecular weight of 349.35 g/mol. Its IUPAC name is 1-methyl-4-[[2-(3-methyl-4-nitropyrazol-1-yl)acetyl]amino]-N-propylpyrazole-5-carboxamide.
| Compound Name | 1-methyl-4-[[2-(3-methyl-4-nitropyrazol-1-yl)acetyl]amino]-N-propylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19396291 |
| Molecular Formula | C14H19N7O4 |
| Molecular Weight | 349.35 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | 1-methyl-4-[[2-(3-methyl-4-nitropyrazol-1-yl)acetyl]amino]-N-propylpyrazole-5-carboxamide |
| SMILES | CCCNC(=O)c1c(NC(=O)Cn2cc([N+](=O)[O-])c(C)n2)cnn1C |
| InChI | InChI=1S/C14H19N7O4/c1-4-5-15-14(23)13-10(6-16-19(13)3)17-12(22)8-20-7-11(21(24)25)9(2)18-20/h6-7H,4-5,8H2,1-3H3,(H,15,23)(H,17,22) |
| InChIKey | ZMASDFUWIAMFCF-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 136.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.35 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|