C12H14BrN5O3 — CID 19342118
methyl 4-[[2-(4-bromo-3-methylpyrazol-1-yl)acetyl]amino]-1-methylpyrazole-5-carboxylate (PubChem CID 19342118) has the molecular formula C12H14BrN5O3 and a molecular weight of 356.18 g/mol. Its IUPAC name is methyl 4-[[2-(4-bromo-3-methylpyrazol-1-yl)acetyl]amino]-1-methylpyrazole-5-carboxylate.
| Compound Name | methyl 4-[[2-(4-bromo-3-methylpyrazol-1-yl)acetyl]amino]-1-methylpyrazole-5-carboxylate |
|---|---|
| PubChem CID | 19342118 |
| Molecular Formula | C12H14BrN5O3 |
| Molecular Weight | 356.18 g/mol |
| Exact Mass | 355.03 |
| IUPAC Name | methyl 4-[[2-(4-bromo-3-methylpyrazol-1-yl)acetyl]amino]-1-methylpyrazole-5-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)Cn2cc(Br)c(C)n2)cnn1C |
| InChI | InChI=1S/C12H14BrN5O3/c1-7-8(13)5-18(16-7)6-10(19)15-9-4-14-17(2)11(9)12(20)21-3/h4-5H,6H2,1-3H3,(H,15,19) |
| InChIKey | GOSATMJYLONBPU-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 91.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.18 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |