C15H17N3O4 — CID 19342293
methyl 1-methyl-4-[[2-(2-methylphenoxy)acetyl]amino]pyrazole-5-carboxylate (PubChem CID 19342293) has the molecular formula C15H17N3O4 and a molecular weight of 303.32 g/mol. Its IUPAC name is methyl 1-methyl-4-[[2-(2-methylphenoxy)acetyl]amino]pyrazole-5-carboxylate.
| Compound Name | methyl 1-methyl-4-[[2-(2-methylphenoxy)acetyl]amino]pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 19342293 |
| Molecular Formula | C15H17N3O4 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | methyl 1-methyl-4-[[2-(2-methylphenoxy)acetyl]amino]pyrazole-5-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)COc2ccccc2C)cnn1C |
| InChI | InChI=1S/C15H17N3O4/c1-10-6-4-5-7-12(10)22-9-13(19)17-11-8-16-18(2)14(11)15(20)21-3/h4-8H,9H2,1-3H3,(H,17,19) |
| InChIKey | ONMHJOZEDLXJNS-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |