C17H18F3N9O4 — CID 19524452
1-methyl-4-[[2-[5-methyl-4-nitro-3-(trifluoromethyl)pyrazol-1-yl]acetyl]amino]-N-[(1-methylpyrazol-4-yl)methyl]pyrazole-5-carboxamide (PubChem CID 19524452) has the molecular formula C17H18F3N9O4 and a molecular weight of 469.38 g/mol. Its IUPAC name is 1-methyl-4-[[2-[5-methyl-4-nitro-3-(trifluoromethyl)pyrazol-1-yl]acetyl]amino]-N-[(1-methylpyrazol-4-yl)methyl]pyrazole-5-carboxamide.
| Compound Name | 1-methyl-4-[[2-[5-methyl-4-nitro-3-(trifluoromethyl)pyrazol-1-yl]acetyl]amino]-N-[(1-methylpyrazol-4-yl)methyl]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19524452 |
| Molecular Formula | C17H18F3N9O4 |
| Molecular Weight | 469.38 g/mol |
| Exact Mass | 469.14 |
| IUPAC Name | 1-methyl-4-[[2-[5-methyl-4-nitro-3-(trifluoromethyl)pyrazol-1-yl]acetyl]amino]-N-[(1-methylpyrazol-4-yl)methyl]pyrazole-5-carboxamide |
| SMILES | Cc1c([N+](=O)[O-])c(C(F)(F)F)nn1CC(=O)Nc1cnn(C)c1C(=O)NCc1cnn(C)c1 |
| InChI | InChI=1S/C17H18F3N9O4/c1-9-13(29(32)33)15(17(18,19)20)25-28(9)8-12(30)24-11-6-23-27(3)14(11)16(31)21-4-10-5-22-26(2)7-10/h5-7H,4,8H2,1-3H3,(H,21,31)(H,24,30) |
| InChIKey | IVLFGLYTUITLQS-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 154.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.38 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|