C14H13F7N6O2 — CID 19336853
4-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-1-methyl-N-[(1-methylpyrazol-4-yl)methyl]pyrazole-5-carboxamide (PubChem CID 19336853) has the molecular formula C14H13F7N6O2 and a molecular weight of 430.28 g/mol. Its IUPAC name is 4-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-1-methyl-N-[(1-methylpyrazol-4-yl)methyl]pyrazole-5-carboxamide.
| Compound Name | 4-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-1-methyl-N-[(1-methylpyrazol-4-yl)methyl]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19336853 |
| Molecular Formula | C14H13F7N6O2 |
| Molecular Weight | 430.28 g/mol |
| Exact Mass | 430.10 |
| IUPAC Name | 4-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-1-methyl-N-[(1-methylpyrazol-4-yl)methyl]pyrazole-5-carboxamide |
| SMILES | Cn1cc(CNC(=O)c2c(NC(=O)C(F)(F)C(F)(F)C(F)(F)F)cnn2C)cn1 |
| InChI | InChI=1S/C14H13F7N6O2/c1-26-6-7(4-23-26)3-22-10(28)9-8(5-24-27(9)2)25-11(29)12(15,16)13(17,18)14(19,20)21/h4-6H,3H2,1-2H3,(H,22,28)(H,25,29) |
| InChIKey | QAHZJOMCEIDIDO-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 93.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.28 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|