C17H17IN6O2 — CID 19336742
4-[(2-iodobenzoyl)amino]-1-methyl-N-[(1-methylpyrazol-4-yl)methyl]pyrazole-5-carboxamide (PubChem CID 19336742) has the molecular formula C17H17IN6O2 and a molecular weight of 464.27 g/mol. Its IUPAC name is 4-[(2-iodobenzoyl)amino]-1-methyl-N-[(1-methylpyrazol-4-yl)methyl]pyrazole-5-carboxamide.
| Compound Name | 4-[(2-iodobenzoyl)amino]-1-methyl-N-[(1-methylpyrazol-4-yl)methyl]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19336742 |
| Molecular Formula | C17H17IN6O2 |
| Molecular Weight | 464.27 g/mol |
| Exact Mass | 464.05 |
| IUPAC Name | 4-[(2-iodobenzoyl)amino]-1-methyl-N-[(1-methylpyrazol-4-yl)methyl]pyrazole-5-carboxamide |
| SMILES | Cn1cc(CNC(=O)c2c(NC(=O)c3ccccc3I)cnn2C)cn1 |
| InChI | InChI=1S/C17H17IN6O2/c1-23-10-11(8-20-23)7-19-17(26)15-14(9-21-24(15)2)22-16(25)12-5-3-4-6-13(12)18/h3-6,8-10H,7H2,1-2H3,(H,19,26)(H,22,25) |
| InChIKey | IYZVKEOVXXFNNL-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 93.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.27 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|