C9H12N4O4 — CID 19516177
2-(3-methoxy-4-nitropyrazol-1-yl)-N-prop-2-enylacetamide (PubChem CID 19516177) has the molecular formula C9H12N4O4 and a molecular weight of 240.22 g/mol. Its IUPAC name is 2-(3-methoxy-4-nitropyrazol-1-yl)-N-prop-2-enylacetamide.
| Compound Name | 2-(3-methoxy-4-nitropyrazol-1-yl)-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 19516177 |
| Molecular Formula | C9H12N4O4 |
| Molecular Weight | 240.22 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | 2-(3-methoxy-4-nitropyrazol-1-yl)-N-prop-2-enylacetamide |
| SMILES | C=CCNC(=O)Cn1cc([N+](=O)[O-])c(OC)n1 |
| InChI | InChI=1S/C9H12N4O4/c1-3-4-10-8(14)6-12-5-7(13(15)16)9(11-12)17-2/h3,5H,1,4,6H2,2H3,(H,10,14) |
| InChIKey | WVYZWXXTNSYXHI-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.22 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|