C18H22N4O6S — CID 27151226
ethyl 5-acetyl-2-[[(2R)-2-(3,5-dimethyl-4-nitropyrazol-1-yl)propanoyl]amino]-4-methylthiophene-3-carboxylate (PubChem CID 27151226) has the molecular formula C18H22N4O6S and a molecular weight of 422.46 g/mol. Its IUPAC name is ethyl 5-acetyl-2-[[(2R)-2-(3,5-dimethyl-4-nitropyrazol-1-yl)propanoyl]amino]-4-methylthiophene-3-carboxylate.
| Compound Name | ethyl 5-acetyl-2-[[(2R)-2-(3,5-dimethyl-4-nitropyrazol-1-yl)propanoyl]amino]-4-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 27151226 |
| Molecular Formula | C18H22N4O6S |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | ethyl 5-acetyl-2-[[(2R)-2-(3,5-dimethyl-4-nitropyrazol-1-yl)propanoyl]amino]-4-methylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)[C@@H](C)n2nc(C)c([N+](=O)[O-])c2C)sc(C(C)=O)c1C |
| InChI | InChI=1S/C18H22N4O6S/c1-7-28-18(25)13-8(2)15(12(6)23)29-17(13)19-16(24)11(5)21-10(4)14(22(26)27)9(3)20-21/h11H,7H2,1-6H3,(H,19,24)/t11-/m1/s1 |
| InChIKey | AGUCPBBPVBJLLC-LLVKDONJSA-N |
| XLogP | 3.36 |
| TPSA | 133.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|