C17H25N7O4 — CID 19402613
1-ethyl-4-[[2-methyl-2-(4-nitropyrazol-1-yl)propanoyl]amino]-N-(2-methylpropyl)pyrazole-3-carboxamide (PubChem CID 19402613) has the molecular formula C17H25N7O4 and a molecular weight of 391.43 g/mol. Its IUPAC name is 1-ethyl-4-[[2-methyl-2-(4-nitropyrazol-1-yl)propanoyl]amino]-N-(2-methylpropyl)pyrazole-3-carboxamide.
| Compound Name | 1-ethyl-4-[[2-methyl-2-(4-nitropyrazol-1-yl)propanoyl]amino]-N-(2-methylpropyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19402613 |
| Molecular Formula | C17H25N7O4 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | 1-ethyl-4-[[2-methyl-2-(4-nitropyrazol-1-yl)propanoyl]amino]-N-(2-methylpropyl)pyrazole-3-carboxamide |
| SMILES | CCn1cc(NC(=O)C(C)(C)n2cc([N+](=O)[O-])cn2)c(C(=O)NCC(C)C)n1 |
| InChI | InChI=1S/C17H25N7O4/c1-6-22-10-13(14(21-22)15(25)18-7-11(2)3)20-16(26)17(4,5)23-9-12(8-19-23)24(27)28/h8-11H,6-7H2,1-5H3,(H,18,25)(H,20,26) |
| InChIKey | VFAGTLQYDYXZLV-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 136.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|