C15H21N7O4 — CID 19339924
1-ethyl-N,N-dimethyl-4-[[2-methyl-2-(4-nitropyrazol-1-yl)propanoyl]amino]pyrazole-5-carboxamide (PubChem CID 19339924) has the molecular formula C15H21N7O4 and a molecular weight of 363.38 g/mol. Its IUPAC name is 1-ethyl-N,N-dimethyl-4-[[2-methyl-2-(4-nitropyrazol-1-yl)propanoyl]amino]pyrazole-5-carboxamide.
| Compound Name | 1-ethyl-N,N-dimethyl-4-[[2-methyl-2-(4-nitropyrazol-1-yl)propanoyl]amino]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19339924 |
| Molecular Formula | C15H21N7O4 |
| Molecular Weight | 363.38 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | 1-ethyl-N,N-dimethyl-4-[[2-methyl-2-(4-nitropyrazol-1-yl)propanoyl]amino]pyrazole-5-carboxamide |
| SMILES | CCn1ncc(NC(=O)C(C)(C)n2cc([N+](=O)[O-])cn2)c1C(=O)N(C)C |
| InChI | InChI=1S/C15H21N7O4/c1-6-20-12(13(23)19(4)5)11(8-16-20)18-14(24)15(2,3)21-9-10(7-17-21)22(25)26/h7-9H,6H2,1-5H3,(H,18,24) |
| InChIKey | LYRAXPDAABTIQD-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 128.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.38 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|