C14H18N6O5 — CID 120697796
2-methyl-2-[4-[[2-methyl-2-(4-nitropyrazol-1-yl)propanoyl]amino]pyrazol-1-yl]propanoic acid (PubChem CID 120697796) has the molecular formula C14H18N6O5 and a molecular weight of 350.34 g/mol. Its IUPAC name is 2-methyl-2-[4-[[2-methyl-2-(4-nitropyrazol-1-yl)propanoyl]amino]pyrazol-1-yl]propanoic acid.
| Compound Name | 2-methyl-2-[4-[[2-methyl-2-(4-nitropyrazol-1-yl)propanoyl]amino]pyrazol-1-yl]propanoic acid |
|---|---|
| PubChem CID | 120697796 |
| Molecular Formula | C14H18N6O5 |
| Molecular Weight | 350.34 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | 2-methyl-2-[4-[[2-methyl-2-(4-nitropyrazol-1-yl)propanoyl]amino]pyrazol-1-yl]propanoic acid |
| SMILES | CC(C)(C(=O)O)n1cc(NC(=O)C(C)(C)n2cc([N+](=O)[O-])cn2)cn1 |
| InChI | InChI=1S/C14H18N6O5/c1-13(2,19-8-10(6-16-19)20(24)25)11(21)17-9-5-15-18(7-9)14(3,4)12(22)23/h5-8H,1-4H3,(H,17,21)(H,22,23) |
| InChIKey | BUPSLZWFYBVCPX-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 145.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.34 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|