C12H14N6O5 — CID 120697013
2-methyl-2-[4-[[2-(4-nitropyrazol-1-yl)acetyl]amino]pyrazol-1-yl]propanoic acid (PubChem CID 120697013) has the molecular formula C12H14N6O5 and a molecular weight of 322.28 g/mol. Its IUPAC name is 2-methyl-2-[4-[[2-(4-nitropyrazol-1-yl)acetyl]amino]pyrazol-1-yl]propanoic acid.
| Compound Name | 2-methyl-2-[4-[[2-(4-nitropyrazol-1-yl)acetyl]amino]pyrazol-1-yl]propanoic acid |
|---|---|
| PubChem CID | 120697013 |
| Molecular Formula | C12H14N6O5 |
| Molecular Weight | 322.28 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | 2-methyl-2-[4-[[2-(4-nitropyrazol-1-yl)acetyl]amino]pyrazol-1-yl]propanoic acid |
| SMILES | CC(C)(C(=O)O)n1cc(NC(=O)Cn2cc([N+](=O)[O-])cn2)cn1 |
| InChI | InChI=1S/C12H14N6O5/c1-12(2,11(20)21)17-5-8(3-14-17)15-10(19)7-16-6-9(4-13-16)18(22)23/h3-6H,7H2,1-2H3,(H,15,19)(H,20,21) |
| InChIKey | HBLIOJWNTLAXCU-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 145.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.28 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|