C14H17F7N4O2 — CID 19402598
1-ethyl-4-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-N-(2-methylpropyl)pyrazole-3-carboxamide (PubChem CID 19402598) has the molecular formula C14H17F7N4O2 and a molecular weight of 406.30 g/mol. Its IUPAC name is 1-ethyl-4-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-N-(2-methylpropyl)pyrazole-3-carboxamide.
| Compound Name | 1-ethyl-4-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-N-(2-methylpropyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19402598 |
| Molecular Formula | C14H17F7N4O2 |
| Molecular Weight | 406.30 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | 1-ethyl-4-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-N-(2-methylpropyl)pyrazole-3-carboxamide |
| SMILES | CCn1cc(NC(=O)C(F)(F)C(F)(F)C(F)(F)F)c(C(=O)NCC(C)C)n1 |
| InChI | InChI=1S/C14H17F7N4O2/c1-4-25-6-8(9(24-25)10(26)22-5-7(2)3)23-11(27)12(15,16)13(17,18)14(19,20)21/h6-7H,4-5H2,1-3H3,(H,22,26)(H,23,27) |
| InChIKey | GKMQKYFDPWXYLE-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.30 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|