C17H22ClN5O2 — CID 19448033
4-[(3-chlorophenyl)carbamoylamino]-1-ethyl-N-(2-methylpropyl)pyrazole-3-carboxamide (PubChem CID 19448033) has the molecular formula C17H22ClN5O2 and a molecular weight of 363.85 g/mol. Its IUPAC name is 4-[(3-chlorophenyl)carbamoylamino]-1-ethyl-N-(2-methylpropyl)pyrazole-3-carboxamide.
| Compound Name | 4-[(3-chlorophenyl)carbamoylamino]-1-ethyl-N-(2-methylpropyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19448033 |
| Molecular Formula | C17H22ClN5O2 |
| Molecular Weight | 363.85 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | 4-[(3-chlorophenyl)carbamoylamino]-1-ethyl-N-(2-methylpropyl)pyrazole-3-carboxamide |
| SMILES | CCn1cc(NC(=O)Nc2cccc(Cl)c2)c(C(=O)NCC(C)C)n1 |
| InChI | InChI=1S/C17H22ClN5O2/c1-4-23-10-14(15(22-23)16(24)19-9-11(2)3)21-17(25)20-13-7-5-6-12(18)8-13/h5-8,10-11H,4,9H2,1-3H3,(H,19,24)(H2,20,21,25) |
| InChIKey | RXRVFIWNDANGMI-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 88.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.85 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |