C19H26N4O4S — CID 19584135
4-[3-(benzenesulfonyl)propanoylamino]-1-ethyl-N-(2-methylpropyl)pyrazole-3-carboxamide (PubChem CID 19584135) has the molecular formula C19H26N4O4S and a molecular weight of 406.51 g/mol. Its IUPAC name is 4-[3-(benzenesulfonyl)propanoylamino]-1-ethyl-N-(2-methylpropyl)pyrazole-3-carboxamide.
| Compound Name | 4-[3-(benzenesulfonyl)propanoylamino]-1-ethyl-N-(2-methylpropyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19584135 |
| Molecular Formula | C19H26N4O4S |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | 4-[3-(benzenesulfonyl)propanoylamino]-1-ethyl-N-(2-methylpropyl)pyrazole-3-carboxamide |
| SMILES | CCn1cc(NC(=O)CCS(=O)(=O)c2ccccc2)c(C(=O)NCC(C)C)n1 |
| InChI | InChI=1S/C19H26N4O4S/c1-4-23-13-16(18(22-23)19(25)20-12-14(2)3)21-17(24)10-11-28(26,27)15-8-6-5-7-9-15/h5-9,13-14H,4,10-12H2,1-3H3,(H,20,25)(H,21,24) |
| InChIKey | NJKFZDDDBORQRL-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 110.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |