C15H21N7O5 — CID 19511123
1-ethyl-4-[(3-methoxy-4-nitro-1H-pyrazole-5-carbonyl)amino]-N-(2-methylpropyl)pyrazole-3-carboxamide (PubChem CID 19511123) has the molecular formula C15H21N7O5 and a molecular weight of 379.38 g/mol. Its IUPAC name is 1-ethyl-4-[(3-methoxy-4-nitro-1H-pyrazole-5-carbonyl)amino]-N-(2-methylpropyl)pyrazole-3-carboxamide.
| Compound Name | 1-ethyl-4-[(3-methoxy-4-nitro-1H-pyrazole-5-carbonyl)amino]-N-(2-methylpropyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19511123 |
| Molecular Formula | C15H21N7O5 |
| Molecular Weight | 379.38 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 1-ethyl-4-[(3-methoxy-4-nitro-1H-pyrazole-5-carbonyl)amino]-N-(2-methylpropyl)pyrazole-3-carboxamide |
| SMILES | CCn1cc(NC(=O)c2[nH]nc(OC)c2[N+](=O)[O-])c(C(=O)NCC(C)C)n1 |
| InChI | InChI=1S/C15H21N7O5/c1-5-21-7-9(10(20-21)13(23)16-6-8(2)3)17-14(24)11-12(22(25)26)15(27-4)19-18-11/h7-8H,5-6H2,1-4H3,(H,16,23)(H,17,24)(H,18,19) |
| InChIKey | KEZIZRFFLNZBDF-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 157.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.38 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|