C22H30N6O6S — CID 19402674
N-[1-ethyl-3-(2-methylpropylcarbamoyl)pyrazol-4-yl]-1-(4-nitrophenyl)sulfonylpiperidine-4-carboxamide (PubChem CID 19402674) has the molecular formula C22H30N6O6S and a molecular weight of 506.59 g/mol. Its IUPAC name is N-[1-ethyl-3-(2-methylpropylcarbamoyl)pyrazol-4-yl]-1-(4-nitrophenyl)sulfonylpiperidine-4-carboxamide.
| Compound Name | N-[1-ethyl-3-(2-methylpropylcarbamoyl)pyrazol-4-yl]-1-(4-nitrophenyl)sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 19402674 |
| Molecular Formula | C22H30N6O6S |
| Molecular Weight | 506.59 g/mol |
| Exact Mass | 506.19 |
| IUPAC Name | N-[1-ethyl-3-(2-methylpropylcarbamoyl)pyrazol-4-yl]-1-(4-nitrophenyl)sulfonylpiperidine-4-carboxamide |
| SMILES | CCn1cc(NC(=O)C2CCN(S(=O)(=O)c3ccc([N+](=O)[O-])cc3)CC2)c(C(=O)NCC(C)C)n1 |
| InChI | InChI=1S/C22H30N6O6S/c1-4-26-14-19(20(25-26)22(30)23-13-15(2)3)24-21(29)16-9-11-27(12-10-16)35(33,34)18-7-5-17(6-8-18)28(31)32/h5-8,14-16H,4,9-13H2,1-3H3,(H,23,30)(H,24,29) |
| InChIKey | UJBAEVYDYQRDFE-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 156.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.59 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|