C22H22FN5O5S — CID 19411725
N-[1-[(4-fluorophenyl)methyl]pyrazol-4-yl]-1-(4-nitrophenyl)sulfonylpiperidine-4-carboxamide (PubChem CID 19411725) has the molecular formula C22H22FN5O5S and a molecular weight of 487.51 g/mol. Its IUPAC name is N-[1-[(4-fluorophenyl)methyl]pyrazol-4-yl]-1-(4-nitrophenyl)sulfonylpiperidine-4-carboxamide.
| Compound Name | N-[1-[(4-fluorophenyl)methyl]pyrazol-4-yl]-1-(4-nitrophenyl)sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 19411725 |
| Molecular Formula | C22H22FN5O5S |
| Molecular Weight | 487.51 g/mol |
| Exact Mass | 487.13 |
| IUPAC Name | N-[1-[(4-fluorophenyl)methyl]pyrazol-4-yl]-1-(4-nitrophenyl)sulfonylpiperidine-4-carboxamide |
| SMILES | O=C(Nc1cnn(Cc2ccc(F)cc2)c1)C1CCN(S(=O)(=O)c2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C22H22FN5O5S/c23-18-3-1-16(2-4-18)14-26-15-19(13-24-26)25-22(29)17-9-11-27(12-10-17)34(32,33)21-7-5-20(6-8-21)28(30)31/h1-8,13,15,17H,9-12,14H2,(H,25,29) |
| InChIKey | WMHHPOSCIAEVDQ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 127.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.51 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|